C22H29BrN3O10P — CID 118970424
propan-2-yl (2R)-2-[[[(2R,3R,4R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118970424) has the molecular formula C22H29BrN3O10P and a molecular weight of 606.36 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118970424 |
| Molecular Formula | C22H29BrN3O10P |
| Molecular Weight | 606.36 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R)-5-(5-bromo-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1OC(n2cc(Br)c(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29BrN3O10P/c1-12(2)34-19(29)13(3)25-37(32,36-14-8-6-5-7-9-14)33-11-16-17(27)22(4,31)20(35-16)26-10-15(23)18(28)24-21(26)30/h5-10,12-13,16-17,20,27,31H,11H2,1-4H3,(H,25,32)(H,24,28,30)/t13-,16-,17-,20?,22-,37-/m1/s1 |
| InChIKey | HKQXQLKBCZWQCU-JLJDPERRSA-N |
| XLogP | 1.44 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|