C22H30N3O8PS2 — CID 174159462
propan-2-yl (2S)-2-[[[(2R,3S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174159462) has the molecular formula C22H30N3O8PS2 and a molecular weight of 559.60 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174159462 |
| Molecular Formula | C22H30N3O8PS2 |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,5R)-5-[2,4-bis(sulfanylidene)pyrimidin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=S)[nH]c2=S)C(C)(O)[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N3O8PS2/c1-13(2)31-19(27)14(3)24-34(29,33-15-8-6-5-7-9-15)30-12-16-18(26)22(4,28)20(32-16)25-11-10-17(35)23-21(25)36/h5-11,13-14,16,18,20,26,28H,12H2,1-4H3,(H,24,29)(H,23,35,36)/t14-,16+,18-,20+,22?,34?/m0/s1 |
| InChIKey | KNQUTCTUIKLLSQ-VEYBKXECSA-N |
| XLogP | 3.42 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|