C24H35N4O9P — CID 155548084
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(ethylamino)-2-oxopyrazin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155548084) has the molecular formula C24H35N4O9P and a molecular weight of 554.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(ethylamino)-2-oxopyrazin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(ethylamino)-2-oxopyrazin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155548084 |
| Molecular Formula | C24H35N4O9P |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-[3-(ethylamino)-2-oxopyrazin-1-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCNc1nccn([C@@H]2O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)[C@@H](O)[C@@]2(C)O)c1=O |
| InChI | InChI=1S/C24H35N4O9P/c1-6-25-20-21(30)28(13-12-26-20)23-24(5,32)19(29)18(36-23)14-34-38(33,37-17-10-8-7-9-11-17)27-16(4)22(31)35-15(2)3/h7-13,15-16,18-19,23,29,32H,6,14H2,1-5H3,(H,25,26)(H,27,33)/t16-,18+,19+,23+,24+,38-/m0/s1 |
| InChIKey | KMGIOIHZMGBBAJ-LKFYKZHASA-N |
| XLogP | 1.82 |
| TPSA | 170.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|