C22H28FN6O9P — CID 90444974
propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90444974) has the molecular formula C22H28FN6O9P and a molecular weight of 570.47 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90444974 |
| Molecular Formula | C22H28FN6O9P |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-4-azido-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28FN6O9P/c1-12(2)36-19(32)13(3)26-39(34,38-14-8-6-5-7-9-14)35-11-16-17(30)22(4,27-28-24)20(37-16)29-10-15(23)18(31)25-21(29)33/h5-10,12-13,16-17,20,30H,11H2,1-4H3,(H,26,34)(H,25,31,33)/t13-,16-,17-,20-,22-,39-/m1/s1 |
| InChIKey | ANHYGQRNAVNKFC-XPJZOOLZSA-N |
| XLogP | 2.14 |
| TPSA | 206.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|