C22H30N3O10P — CID 86297233
propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-5-(6-deuterio-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 86297233) has the molecular formula C22H30N3O10P and a molecular weight of 530.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-5-(6-deuterio-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-5-(6-deuterio-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86297233 |
| Molecular Formula | C22H30N3O10P |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-5-(6-deuterio-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | [2H]c1cc(=O)[nH]c(=O)n1[C@@H]1O[C@H](C([2H])([2H])OP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C22H30N3O10P/c1-13(2)33-19(28)14(3)24-36(31,35-15-8-6-5-7-9-15)32-12-16-18(27)22(4,30)20(34-16)25-11-10-17(26)23-21(25)29/h5-11,13-14,16,18,20,27,30H,12H2,1-4H3,(H,24,31)(H,23,26,29)/t14-,16+,18+,20+,22+,36?/m0/s1/i11D,12D2 |
| InChIKey | WAKQLZVLNOKKHE-JOENFODMSA-N |
| XLogP | 0.68 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|