C22H29FN3O9P — CID 121325177
propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 121325177) has the molecular formula C22H29FN3O9P and a molecular weight of 532.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 121325177 |
| Molecular Formula | C22H29FN3O9P |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[dideuterio-[(2R,3R,4R,5R)-2-deuterio-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | [2H]C([2H])(O[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@@]1([2H])O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C22H29FN3O9P/c1-13(2)33-19(29)14(3)25-36(31,35-15-8-6-5-7-9-15)32-12-16-18(28)22(4,23)20(34-16)26-11-10-17(27)24-21(26)30/h5-11,13-14,16,18,20,28H,12H2,1-4H3,(H,25,31)(H,24,27,30)/t14-,16+,18+,20+,22+,36-/m0/s1/i12D2,16D |
| InChIKey | TTZHDVOVKQGIBA-YPNWLELWSA-N |
| XLogP | 1.66 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|