C22H30N3O9PS — CID 56947769
propan-2-yl 2-[[[dideuterio-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 56947769) has the molecular formula C22H30N3O9PS and a molecular weight of 545.55 g/mol. Its IUPAC name is propan-2-yl 2-[[[dideuterio-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[dideuterio-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 56947769 |
| Molecular Formula | C22H30N3O9PS |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | propan-2-yl 2-[[[dideuterio-[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | [2H]C([2H])(OP(=S)(NC(C)C(=O)OC(C)C)Oc1ccccc1)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C22H30N3O9PS/c1-13(2)32-19(28)14(3)24-35(36,34-15-8-6-5-7-9-15)31-12-16-18(27)22(4,30)20(33-16)25-11-10-17(26)23-21(25)29/h5-11,13-14,16,18,20,27,30H,12H2,1-4H3,(H,24,36)(H,23,26,29)/t14?,16-,18-,20-,22-,35?/m1/s1/i12D2 |
| InChIKey | XFJMOMBVBMXWCV-IZBZGPSPSA-N |
| XLogP | 0.80 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|