C23H30N3O9PS — CID 118049077
propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(2,4-dioxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118049077) has the molecular formula C23H30N3O9PS and a molecular weight of 555.55 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(2,4-dioxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(2,4-dioxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118049077 |
| Molecular Formula | C23H30N3O9PS |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(2,4-dioxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=S)(OC[C@]12CO[C@](C)([C@@H]1O)[C@H](n1ccc(=O)[nH]c1=O)O2)Oc1ccccc1 |
| InChI | InChI=1S/C23H30N3O9PS/c1-14(2)33-18(28)15(3)25-36(37,35-16-8-6-5-7-9-16)32-13-23-12-31-22(4,19(23)29)20(34-23)26-11-10-17(27)24-21(26)30/h5-11,14-15,19-20,29H,12-13H2,1-4H3,(H,25,37)(H,24,27,30)/t15-,19+,20-,22-,23-,36?/m1/s1 |
| InChIKey | KSJFICYFWFTJKK-GQQDIBNVSA-N |
| XLogP | 1.20 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|