C27H36N3O9PS — CID 163903654
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate (PubChem CID 163903654) has the molecular formula C27H36N3O9PS and a molecular weight of 609.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 163903654 |
| Molecular Formula | C27H36N3O9PS |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
| SMILES | C#C[C@]1(O)[C@H](n2ccc(=O)[nH]c2=O)O[C@@](C)(COP(=S)(N[C@@H](CC(C)C)C(=O)OC(C)C)Oc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C27H36N3O9PS/c1-7-27(35)23(33)26(6,38-24(27)30-14-13-21(31)28-25(30)34)16-36-40(41,39-19-11-9-8-10-12-19)29-20(15-17(2)3)22(32)37-18(4)5/h1,8-14,17-18,20,23-24,33,35H,15-16H2,2-6H3,(H,29,41)(H,28,31,34)/t20-,23+,24+,26-,27+,40?/m0/s1 |
| InChIKey | QMAIGOJHJXCQAM-LHALJBRUSA-N |
| XLogP | 1.83 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|