C23H27IN3O9PS — CID 118019559
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-iodopropanoate (PubChem CID 118019559) has the molecular formula C23H27IN3O9PS and a molecular weight of 679.43 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-iodopropanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-iodopropanoate |
|---|---|
| PubChem CID | 118019559 |
| Molecular Formula | C23H27IN3O9PS |
| Molecular Weight | 679.43 g/mol |
| Exact Mass | 679.03 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-iodopropanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=S)(N[C@@H](CI)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H27IN3O9PS/c1-4-23(32)19(29)17(35-21(23)27-11-10-18(28)25-22(27)31)13-33-37(38,36-15-8-6-5-7-9-15)26-16(12-24)20(30)34-14(2)3/h1,5-11,14,16-17,19,21,29,32H,12-13H2,2-3H3,(H,26,38)(H,25,28,31)/t16-,17+,19+,21+,23+,37?/m0/s1 |
| InChIKey | SVQQMXVNGFZWOO-YGKLTKILSA-N |
| XLogP | 0.82 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|