C25H32N3O9PS — CID 71617164
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-methylbutanoate (PubChem CID 71617164) has the molecular formula C25H32N3O9PS and a molecular weight of 581.58 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-methylbutanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 71617164 |
| Molecular Formula | C25H32N3O9PS |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]-3-methylbutanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=S)(NC(C(=O)OC(C)C)C(C)C)Oc2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C25H32N3O9PS/c1-6-25(33)21(30)18(36-23(25)28-13-12-19(29)26-24(28)32)14-34-38(39,37-17-10-8-7-9-11-17)27-20(15(2)3)22(31)35-16(4)5/h1,7-13,15-16,18,20-21,23,30,33H,14H2,2-5H3,(H,27,39)(H,26,29,32)/t18-,20?,21-,23-,25-,38?/m1/s1 |
| InChIKey | DWJHEOCAXMTGRV-HOLWMCGBSA-N |
| XLogP | 1.05 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|