C24H34N3O9PS — CID 66804778
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]pentanoate (PubChem CID 66804778) has the molecular formula C24H34N3O9PS and a molecular weight of 571.59 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]pentanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]pentanoate |
|---|---|
| PubChem CID | 66804778 |
| Molecular Formula | C24H34N3O9PS |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]pentanoate |
| SMILES | CCC[C@H](NP(=S)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C24H34N3O9PS/c1-5-9-17(21(30)34-15(2)3)26-37(38,36-16-10-7-6-8-11-16)33-14-18-20(29)24(4,32)22(35-18)27-13-12-19(28)25-23(27)31/h6-8,10-13,15,17-18,20,22,29,32H,5,9,14H2,1-4H3,(H,26,38)(H,25,28,31)/t17-,18+,20+,22+,24+,37?/m0/s1 |
| InChIKey | DVJNSFVXBPSOBR-PZSNXWJUSA-N |
| XLogP | 1.58 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|