C23H31N4O8PS — CID 118049048
propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(4-amino-2-oxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118049048) has the molecular formula C23H31N4O8PS and a molecular weight of 554.56 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(4-amino-2-oxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(4-amino-2-oxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118049048 |
| Molecular Formula | C23H31N4O8PS |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(1R,3R,4R,7R)-3-(4-amino-2-oxopyrimidin-1-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=S)(OC[C@]12CO[C@](C)([C@@H]1O)[C@H](n1ccc(N)nc1=O)O2)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N4O8PS/c1-14(2)33-18(28)15(3)26-36(37,35-16-8-6-5-7-9-16)32-13-23-12-31-22(4,19(23)29)20(34-23)27-11-10-17(24)25-21(27)30/h5-11,14-15,19-20,29H,12-13H2,1-4H3,(H,26,37)(H2,24,25,30)/t15-,19+,20-,22-,23-,36?/m1/s1 |
| InChIKey | AMDGPNQXOQHWGD-GQQDIBNVSA-N |
| XLogP | 1.49 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|