C26H35N6O9P — CID 90125480
propan-2-yl (2S)-2-[[[(1R,3R,4R,7R)-3-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90125480) has the molecular formula C26H35N6O9P and a molecular weight of 606.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,3R,4R,7R)-3-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,3R,4R,7R)-3-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90125480 |
| Molecular Formula | C26H35N6O9P |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,3R,4R,7R)-3-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-4-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@]2(CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)CO[C@]1(C)[C@@H]2O |
| InChI | InChI=1S/C26H35N6O9P/c1-6-36-20-18-19(29-24(27)30-20)32(14-28-18)23-25(5)22(34)26(40-23,12-37-25)13-38-42(35,41-17-10-8-7-9-11-17)31-16(4)21(33)39-15(2)3/h7-11,14-16,22-23,34H,6,12-13H2,1-5H3,(H,31,35)(H2,27,29,30)/t16-,22-,23+,25+,26+,42-/m0/s1 |
| InChIKey | WRHZCIZNXPRSDA-PSMLCWFUSA-N |
| XLogP | 2.36 |
| TPSA | 191.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|