C25H36N6O7P2S — CID 170246077
propan-2-yl (2S)-2-[[[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170246077) has the molecular formula C25H36N6O7P2S and a molecular weight of 626.61 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170246077 |
| Molecular Formula | C25H36N6O7P2S |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1OC(COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](S)[C@@]1(C)P |
| InChI | InChI=1S/C25H36N6O7P2S/c1-6-34-21-18-20(28-24(26)29-21)31(13-27-18)23-25(5,39)19(41)17(37-23)12-35-40(33,38-16-10-8-7-9-11-16)30-15(4)22(32)36-14(2)3/h7-11,13-15,17,19,23,41H,6,12,39H2,1-5H3,(H,30,33)(H2,26,28,29)/t15-,17?,19+,23+,25+,40?/m0/s1 |
| InChIKey | XUKQMYMNYKSXCI-NGTCRSTISA-N |
| XLogP | 3.77 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|