C23H37N5O12P2S — CID 170246072
[[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 170246072) has the molecular formula C23H37N5O12P2S and a molecular weight of 669.59 g/mol. Its IUPAC name is [[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 170246072 |
| Molecular Formula | C23H37N5O12P2S |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | [[(3R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyl-4-phosphanyl-3-sulfanyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1OC(COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)[C@@H](S)[C@@]1(C)P |
| InChI | InChI=1S/C23H37N5O12P2S/c1-7-32-18-15-17(26-20(24)27-18)28(9-25-15)19-23(6,41)16(43)14(40-19)8-35-42(31,36-10-33-21(29)38-12(2)3)37-11-34-22(30)39-13(4)5/h9,12-14,16,19,43H,7-8,10-11,41H2,1-6H3,(H2,24,26,27)/t14?,16-,19-,23-/m1/s1 |
| InChIKey | HIVHTQVEYSULON-ONGIYQGESA-N |
| XLogP | 3.83 |
| TPSA | 203.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|