C25H38F2N5O13P — CID 161055863
[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-4-methyl-3-(2-tritiooxyethyl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 161055863) has the molecular formula C25H38F2N5O13P and a molecular weight of 687.58 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-4-methyl-3-(2-tritiooxyethyl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-4-methyl-3-(2-tritiooxyethyl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 161055863 |
| Molecular Formula | C25H38F2N5O13P |
| Molecular Weight | 687.58 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-4-methyl-3-(2-tritiooxyethyl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | [3H]OCC[C@H]1[C@@](C)(F)[C@H](n2cnc3c(OCC)nc(N)nc32)O[C@]1(F)COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C25H38F2N5O13P/c1-7-37-19-17-18(30-21(28)31-19)32(11-29-17)20-24(6,26)16(8-9-33)25(27,45-20)10-40-46(36,41-12-38-22(34)43-14(2)3)42-13-39-23(35)44-15(4)5/h11,14-16,20,33H,7-10,12-13H2,1-6H3,(H2,28,30,31)/t16-,20+,24+,25+/m0/s1/i33T |
| InChIKey | CKFOCMIPKIVESV-HNASZRQNSA-N |
| XLogP | 3.92 |
| TPSA | 224.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|