C23H33F2N4O12P — CID 126549457
[[(2S,3S,4R,5R)-5-(2,6-dimethylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 126549457) has the molecular formula C23H33F2N4O12P and a molecular weight of 626.50 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2,6-dimethylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2,6-dimethylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 126549457 |
| Molecular Formula | C23H33F2N4O12P |
| Molecular Weight | 626.50 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2,6-dimethylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | Cc1nc(C)c2ncn([C@@H]3O[C@](F)(COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)[C@@H](O)[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C23H33F2N4O12P/c1-12(2)39-20(31)34-10-37-42(33,38-11-35-21(32)40-13(3)4)36-8-23(25)18(30)22(7,24)19(41-23)29-9-26-16-14(5)27-15(6)28-17(16)29/h9,12-13,18-19,30H,8,10-11H2,1-7H3/t18-,19+,22+,23+/m0/s1 |
| InChIKey | AVIZPAOSXDUZGH-TWRVUUBYSA-N |
| XLogP | 3.92 |
| TPSA | 188.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|