C30H39F2N6O7P — CID 158341257
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dicyclopropylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 158341257) has the molecular formula C30H39F2N6O7P and a molecular weight of 664.65 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dicyclopropylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dicyclopropylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158341257 |
| Molecular Formula | C30H39F2N6O7P |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(dicyclopropylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc(N(C2CC2)C2CC2)c2ncn([C@@H]3O[C@](F)(CO[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc4ccccc4)[C@@H](O)[C@@]3(C)F)c2n1 |
| InChI | InChI=1S/C30H39F2N6O7P/c1-17(2)43-26(39)18(3)36-46(41,45-22-9-7-6-8-10-22)42-15-30(32)27(40)29(5,31)28(44-30)37-16-33-23-24(37)34-19(4)35-25(23)38(20-11-12-20)21-13-14-21/h6-10,16-18,20-21,27-28,40H,11-15H2,1-5H3,(H,36,41)/t18-,27-,28+,29+,30+,46+/m0/s1 |
| InChIKey | YHWHGMSBTYLFPF-NLEDQSDFSA-N |
| XLogP | 4.68 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|