C27H36F2N7O7P — CID 138647032
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 138647032) has the molecular formula C27H36F2N7O7P and a molecular weight of 639.60 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138647032 |
| Molecular Formula | C27H36F2N7O7P |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-pyrrolidin-1-ylpurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(F)O[C@@H](n2cnc3c(N4CCCC4)nc(N)nc32)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H36F2N7O7P/c1-16(2)41-22(37)17(3)34-44(39,43-18-10-6-5-7-11-18)40-14-27(29)23(38)26(4,28)24(42-27)36-15-31-19-20(35-12-8-9-13-35)32-25(30)33-21(19)36/h5-7,10-11,15-17,23-24,38H,8-9,12-14H2,1-4H3,(H,34,39)(H2,30,32,33)/t17-,23-,24+,26+,27+,44?/m0/s1 |
| InChIKey | ZOCFNSWPSVMXOZ-AVDLYYPHSA-N |
| XLogP | 3.43 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|