C26H36F2N7O7P — CID 138647506
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(propan-2-ylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 138647506) has the molecular formula C26H36F2N7O7P and a molecular weight of 627.59 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(propan-2-ylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(propan-2-ylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138647506 |
| Molecular Formula | C26H36F2N7O7P |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[2-amino-6-(propan-2-ylamino)purin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)Nc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(CO[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C26H36F2N7O7P/c1-14(2)31-19-18-20(33-24(29)32-19)35(13-30-18)23-25(6,27)22(37)26(28,41-23)12-39-43(38,42-17-10-8-7-9-11-17)34-16(5)21(36)40-15(3)4/h7-11,13-16,22-23,37H,12H2,1-6H3,(H,34,38)(H3,29,31,32,33)/t16-,22-,23+,25+,26+,43+/m0/s1 |
| InChIKey | QGVHYEDCEFVVCR-XLENKDHPSA-N |
| XLogP | 3.65 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|