C26H35F2N6O7P — CID 158110903
propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 158110903) has the molecular formula C26H35F2N6O7P and a molecular weight of 612.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 158110903 |
| Molecular Formula | C26H35F2N6O7P |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,3S,4R,5R)-5-[6-(ethylamino)-2-methylpurin-9-yl]-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCNc1nc(C)nc2c1ncn2[C@@H]1O[C@](F)(CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C26H35F2N6O7P/c1-7-29-20-19-21(32-17(5)31-20)34(14-30-19)24-25(6,27)23(36)26(28,40-24)13-38-42(37,41-18-11-9-8-10-12-18)33-16(4)22(35)39-15(2)3/h8-12,14-16,23-24,36H,7,13H2,1-6H3,(H,33,37)(H,29,31,32)/t16-,23-,24+,25+,26+,42-/m0/s1 |
| InChIKey | HLWKQRCEVQDDRS-VOVOAURVSA-N |
| XLogP | 3.98 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|