C26H35F2N6O8P — CID 90251562
2-methylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251562) has the molecular formula C26H35F2N6O8P and a molecular weight of 628.57 g/mol. Its IUPAC name is 2-methylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-methylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251562 |
| Molecular Formula | C26H35F2N6O8P |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 2-methylpropyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(COP(=O)(N[C@@H](C)C(=O)OCC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C26H35F2N6O8P/c1-6-38-20-18-19(31-24(29)32-20)34(14-30-18)23-25(5,27)22(36)26(28,41-23)13-40-43(37,42-17-10-8-7-9-11-17)33-16(4)21(35)39-12-15(2)3/h7-11,14-16,22-23,36H,6,12-13H2,1-5H3,(H,33,37)(H2,29,31,32)/t16-,22-,23+,25+,26+,43?/m0/s1 |
| InChIKey | HVLXBRXXFNHWPD-KXLGIXJPSA-N |
| XLogP | 3.47 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|