C25H34N9O7P — CID 161303803
(3S)-3-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-phenylethoxy)phosphoryl]amino]butan-2-one (PubChem CID 161303803) has the molecular formula C25H34N9O7P and a molecular weight of 603.58 g/mol. Its IUPAC name is (3S)-3-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-phenylethoxy)phosphoryl]amino]butan-2-one.
| Compound Name | (3S)-3-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-phenylethoxy)phosphoryl]amino]butan-2-one |
|---|---|
| PubChem CID | 161303803 |
| Molecular Formula | C25H34N9O7P |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | (3S)-3-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1-phenylethoxy)phosphoryl]amino]butan-2-one |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(C)=O)OC(C)c2ccccc2)[C@@H](O)[C@@]1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C25H34N9O7P/c1-6-38-22-19-21(29-24(26)30-22)34(13-28-19)23-25(5,32-33-27)20(36)18(40-23)12-39-42(37,31-14(2)15(3)35)41-16(4)17-10-8-7-9-11-17/h7-11,13-14,16,18,20,23,36H,6,12H2,1-5H3,(H,31,37)(H2,26,29,30)/t14-,16?,18+,20+,23+,25+,42?/m0/s1 |
| InChIKey | VHYXRNMWGDJXAT-GUYAERNVSA-N |
| XLogP | 3.60 |
| TPSA | 221.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|