C24H32N9O7P — CID 118438306
(3S)-3-[[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylethoxy]phosphoryl]amino]butan-2-one (PubChem CID 118438306) has the molecular formula C24H32N9O7P and a molecular weight of 589.55 g/mol. Its IUPAC name is (3S)-3-[[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylethoxy]phosphoryl]amino]butan-2-one.
| Compound Name | (3S)-3-[[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylethoxy]phosphoryl]amino]butan-2-one |
|---|---|
| PubChem CID | 118438306 |
| Molecular Formula | C24H32N9O7P |
| Molecular Weight | 589.55 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (3S)-3-[[[(2R,3S,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylethoxy]phosphoryl]amino]butan-2-one |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(C)=O)O[C@@H](C)c2ccccc2)[C@@H](O)C1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C24H32N9O7P/c1-13(14(2)34)30-41(36,40-15(3)16-9-7-6-8-10-16)38-11-17-19(35)24(4,31-32-26)22(39-17)33-12-27-18-20(33)28-23(25)29-21(18)37-5/h6-10,12-13,15,17,19,22,35H,11H2,1-5H3,(H,30,36)(H2,25,28,29)/t13-,15-,17+,19+,22+,24?,41?/m0/s1 |
| InChIKey | YVTDCSBKKPWIEB-QOHNXUCKSA-N |
| XLogP | 3.21 |
| TPSA | 221.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|