C23H29ClN9O8P — CID 90299907
ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 90299907) has the molecular formula C23H29ClN9O8P and a molecular weight of 625.97 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90299907 |
| Molecular Formula | C23H29ClN9O8P |
| Molecular Weight | 625.97 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN9O8P/c1-5-38-20(35)12(2)30-42(36,41-14-8-6-13(24)7-9-14)39-10-15-17(34)23(3,31-32-26)21(40-15)33-11-27-16-18(33)28-22(25)29-19(16)37-4/h6-9,11-12,15,17,21,34H,5,10H2,1-4H3,(H,30,36)(H2,25,28,29)/t12-,15+,17+,21+,23+,42?/m0/s1 |
| InChIKey | BPDWBDAKAVSEJL-XBBQKOMRSA-N |
| XLogP | 3.14 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.97 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|