C29H42N9O8P — CID 90300302
ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylpentoxy]phosphoryl]amino]propanoate (PubChem CID 90300302) has the molecular formula C29H42N9O8P and a molecular weight of 675.68 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylpentoxy]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylpentoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90300302 |
| Molecular Formula | C29H42N9O8P |
| Molecular Weight | 675.68 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-[(1S)-1-phenylpentoxy]phosphoryl]amino]propanoate |
| SMILES | CCCC[C@H](OP(=O)(N[C@@H](C)C(=O)OCC)OC[C@H]1O[C@@H](n2cnc3c(OCC)nc(N)nc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C29H42N9O8P/c1-6-9-15-20(19-13-11-10-12-14-19)46-47(41,35-18(4)26(40)43-8-3)44-16-21-23(39)29(5,36-37-31)27(45-21)38-17-32-22-24(38)33-28(30)34-25(22)42-7-2/h10-14,17-18,20-21,23,27,39H,6-9,15-16H2,1-5H3,(H,35,41)(H2,30,33,34)/t18-,20-,21+,23+,27+,29+,47?/m0/s1 |
| InChIKey | OPMQXFTWQQRXKR-HQNSDICYSA-N |
| XLogP | 4.75 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|