C26H34N9O8P — CID 90299923
ethyl (2S)-2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclopropylamino)phosphoryl]oxy-2-phenylacetate (PubChem CID 90299923) has the molecular formula C26H34N9O8P and a molecular weight of 631.59 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclopropylamino)phosphoryl]oxy-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclopropylamino)phosphoryl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 90299923 |
| Molecular Formula | C26H34N9O8P |
| Molecular Weight | 631.59 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | ethyl (2S)-2-[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(cyclopropylamino)phosphoryl]oxy-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](O[P@@](=O)(NC1CC1)OC[C@H]1O[C@@H](n2cnc3c(OCC)nc(N)nc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C26H34N9O8P/c1-4-39-22-18-21(30-25(27)31-22)35(14-29-18)24-26(3,33-34-28)20(36)17(42-24)13-41-44(38,32-16-11-12-16)43-19(23(37)40-5-2)15-9-7-6-8-10-15/h6-10,14,16-17,19-20,24,36H,4-5,11-13H2,1-3H3,(H,32,38)(H2,27,30,31)/t17-,19+,20-,24-,26-,44-/m1/s1 |
| InChIKey | SZYXRXWMSLQVPK-PFDLCIMVSA-N |
| XLogP | 3.33 |
| TPSA | 230.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|