C27H36N9O10P — CID 90299939
butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1,3-benzodioxol-5-yloxy)phosphoryl]amino]propanoate (PubChem CID 90299939) has the molecular formula C27H36N9O10P and a molecular weight of 677.61 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1,3-benzodioxol-5-yloxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1,3-benzodioxol-5-yloxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90299939 |
| Molecular Formula | C27H36N9O10P |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-(1,3-benzodioxol-5-yloxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OCC)nc(N)nc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H36N9O10P/c1-5-7-10-41-24(38)15(3)33-47(39,46-16-8-9-17-18(11-16)43-14-42-17)44-12-19-21(37)27(4,34-35-29)25(45-19)36-13-30-20-22(36)31-26(28)32-23(20)40-6-2/h8-9,11,13,15,19,21,25,37H,5-7,10,12,14H2,1-4H3,(H,33,39)(H2,28,31,32)/t15-,19+,21+,25+,27+,47?/m0/s1 |
| InChIKey | LBOANIOQZLPNSR-GCGUZPBUSA-N |
| XLogP | 3.39 |
| TPSA | 249.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|