C29H34N9O8P — CID 89096694
propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-4-methyl-3-oxooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 89096694) has the molecular formula C29H34N9O8P and a molecular weight of 667.62 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-4-methyl-3-oxooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-4-methyl-3-oxooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 89096694 |
| Molecular Formula | C29H34N9O8P |
| Molecular Weight | 667.62 g/mol |
| Exact Mass | 667.23 |
| IUPAC Name | propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-azido-4-methyl-3-oxooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(OCC)nc(N)nc32)[C@](C)(N=[N+]=[N-])C1=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C29H34N9O8P/c1-5-14-43-26(40)17(3)35-47(41,46-20-13-9-11-18-10-7-8-12-19(18)20)44-15-21-23(39)29(4,36-37-31)27(45-21)38-16-32-22-24(38)33-28(30)34-25(22)42-6-2/h7-13,16-17,21,27H,5-6,14-15H2,1-4H3,(H,35,41)(H2,30,33,34)/t17-,21+,27+,29+,47?/m0/s1 |
| InChIKey | XYEHIOAMYIMBBP-MQWXHNPFSA-N |
| XLogP | 4.63 |
| TPSA | 227.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|