C22H29FN3O9PS — CID 118191433
propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118191433) has the molecular formula C22H29FN3O9PS and a molecular weight of 561.53 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118191433 |
| Molecular Formula | C22H29FN3O9PS |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluoro-4-hydroxy-2-methoxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CO[C@]1(COP(=S)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C22H29FN3O9PS/c1-13(2)33-20(29)14(3)25-36(37,35-15-8-6-5-7-9-15)32-12-22(31-4)18(23)17(28)19(34-22)26-11-10-16(27)24-21(26)30/h5-11,13-14,17-19,28H,12H2,1-4H3,(H,25,37)(H,24,27,30)/t14-,17-,18+,19-,22-,36?/m1/s1 |
| InChIKey | NWWKMOWYYLYEFJ-UQOFPENISA-N |
| XLogP | 1.36 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|