C22H29N6O9PS — CID 56961181
propan-2-yl 3-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate (PubChem CID 56961181) has the molecular formula C22H29N6O9PS and a molecular weight of 584.55 g/mol. Its IUPAC name is propan-2-yl 3-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate.
| Compound Name | propan-2-yl 3-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate |
|---|---|
| PubChem CID | 56961181 |
| Molecular Formula | C22H29N6O9PS |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | propan-2-yl 3-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]butanoate |
| SMILES | CC(CC(=O)OC(C)C)NP(=S)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H29N6O9PS/c1-13(2)35-17(30)11-14(3)25-38(39,37-15-7-5-4-6-8-15)34-12-22(26-27-23)19(32)18(31)20(36-22)28-10-9-16(29)24-21(28)33/h4-10,13-14,18-20,31-32H,11-12H2,1-3H3,(H,25,39)(H,24,29,33)/t14?,18-,19+,20-,22-,38?/m1/s1 |
| InChIKey | WOAXRMMHEISKIS-NKXVYTNJSA-N |
| XLogP | 1.43 |
| TPSA | 210.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|