C25H28BrN6O10P — CID 130297038
(2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(1-bromonaphthalen-2-yl)oxyphosphoryl]amino]-4-methylpentanoic acid (PubChem CID 130297038) has the molecular formula C25H28BrN6O10P and a molecular weight of 683.41 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(1-bromonaphthalen-2-yl)oxyphosphoryl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(1-bromonaphthalen-2-yl)oxyphosphoryl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 130297038 |
| Molecular Formula | C25H28BrN6O10P |
| Molecular Weight | 683.41 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(1-bromonaphthalen-2-yl)oxyphosphoryl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)Oc1ccc2ccccc2c1Br)C(=O)O |
| InChI | InChI=1S/C25H28BrN6O10P/c1-13(2)11-16(23(36)37)29-43(39,42-17-8-7-14-5-3-4-6-15(14)19(17)26)40-12-25(30-31-27)21(35)20(34)22(41-25)32-10-9-18(33)28-24(32)38/h3-10,13,16,20-22,34-35H,11-12H2,1-2H3,(H,29,39)(H,36,37)(H,28,33,38)/t16-,20+,21-,22+,25+,43?/m0/s1 |
| InChIKey | BGDPEYTYEOBNJE-WQVLWDTASA-N |
| XLogP | 3.00 |
| TPSA | 238.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|