C27H38ClN6O9P — CID 51347526
2-propylpentyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 51347526) has the molecular formula C27H38ClN6O9P and a molecular weight of 657.06 g/mol. Its IUPAC name is 2-propylpentyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | 2-propylpentyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 51347526 |
| Molecular Formula | C27H38ClN6O9P |
| Molecular Weight | 657.06 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 2-propylpentyl (2S)-2-[[[(2R,3S,4S,5R)-2-azido-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCC(CCC)COC(=O)[C@H](C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](C)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H38ClN6O9P/c1-5-7-19(8-6-2)15-40-25(37)18(4)31-44(39,43-21-11-9-20(28)10-12-21)41-16-27(32-33-29)23(36)17(3)24(42-27)34-14-13-22(35)30-26(34)38/h9-14,17-19,23-24,36H,5-8,15-16H2,1-4H3,(H,31,39)(H,30,35,38)/t17-,18-,23-,24+,27+,44?/m0/s1 |
| InChIKey | RPJUNLDYZPLQEF-XDWKRTECSA-N |
| XLogP | 4.66 |
| TPSA | 206.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|