C21H27N6O10P — CID 91536442
ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 91536442) has the molecular formula C21H27N6O10P and a molecular weight of 554.45 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 91536442 |
| Molecular Formula | C21H27N6O10P |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2c(=O)cc[nH]c2=O)[C@H](O)[C@@H]1O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C21H27N6O10P/c1-4-34-19(31)13(3)24-38(33,37-14-7-5-12(2)6-8-14)35-11-21(25-26-22)17(30)16(29)18(36-21)27-15(28)9-10-23-20(27)32/h5-10,13,16-18,29-30H,4,11H2,1-3H3,(H,23,32)(H,24,33)/t13-,16+,17-,18+,21+,38?/m0/s1 |
| InChIKey | MCPVUGBDXRTGLN-JZCNIYLDSA-N |
| XLogP | 0.85 |
| TPSA | 227.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|