C22H30N7O9P — CID 45267462
tert-butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 45267462) has the molecular formula C22H30N7O9P and a molecular weight of 567.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 45267462 |
| Molecular Formula | C22H30N7O9P |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | tert-butyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N7O9P/c1-13(19(32)37-21(2,3)4)26-39(34,38-14-8-6-5-7-9-14)35-12-22(27-28-24)17(31)16(30)18(36-22)29-11-10-15(23)25-20(29)33/h5-11,13,16-18,30-31H,12H2,1-4H3,(H,26,34)(H2,23,25,33)/t13-,16+,17-,18+,22+,39?/m0/s1 |
| InChIKey | BFZCGMDFAZRYHK-YLUMJRNZSA-N |
| XLogP | 1.61 |
| TPSA | 233.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|