C25H35N4O9P — CID 121245902
2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 121245902) has the molecular formula C25H35N4O9P and a molecular weight of 566.55 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 121245902 |
| Molecular Formula | C25H35N4O9P |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@]1(COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2ccccc2)O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H35N4O9P/c1-6-25(20(31)19(30)21(37-25)29-13-12-18(26)27-23(29)33)15-36-39(34,38-17-10-8-7-9-11-17)28-16(2)22(32)35-14-24(3,4)5/h6-13,16,19-21,30-31H,1,14-15H2,2-5H3,(H,28,34)(H2,26,27,33)/t16-,19+,20-,21+,25+,39?/m0/s1 |
| InChIKey | AQVUFDBYNBCTRL-QQZGJOOZSA-N |
| XLogP | 1.77 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|