C27H29ClN3O10P — CID 87710294
benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-[(Z)-2-chloroethenyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 87710294) has the molecular formula C27H29ClN3O10P and a molecular weight of 621.97 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-[(Z)-2-chloroethenyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-[(Z)-2-chloroethenyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 87710294 |
| Molecular Formula | C27H29ClN3O10P |
| Molecular Weight | 621.97 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-2-[(Z)-2-chloroethenyl]-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(/C=C\Cl)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H29ClN3O10P/c1-18(25(35)38-16-19-8-4-2-5-9-19)30-42(37,41-20-10-6-3-7-11-20)39-17-27(13-14-28)23(34)22(33)24(40-27)31-15-12-21(32)29-26(31)36/h2-15,18,22-24,33-34H,16-17H2,1H3,(H,30,37)(H,29,32,36)/b14-13-/t18-,22+,23-,24+,27+,42?/m0/s1 |
| InChIKey | PSMHXMLHRRZMOT-WKGLHHGJSA-N |
| XLogP | 2.20 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.97 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|