C20H33N4O10P — CID 175677829
propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-propan-2-ylperoxyphosphoryl]amino]propanoate (PubChem CID 175677829) has the molecular formula C20H33N4O10P and a molecular weight of 520.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-propan-2-ylperoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-propan-2-ylperoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 175677829 |
| Molecular Formula | C20H33N4O10P |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3,4-dihydroxyoxolan-2-yl]methoxy-propan-2-ylperoxyphosphoryl]amino]propanoate |
| SMILES | C=C[C@]1(COP(=O)(N[C@@H](C)C(=O)OC(C)C)OOC(C)C)O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H33N4O10P/c1-7-20(16(26)15(25)17(32-20)24-9-8-14(21)22-19(24)28)10-30-35(29,34-33-12(4)5)23-13(6)18(27)31-11(2)3/h7-9,11-13,15-17,25-26H,1,10H2,2-6H3,(H,23,29)(H2,21,22,28)/t13-,15+,16-,17+,20+,35?/m0/s1 |
| InChIKey | BBGUDFABXXWSBJ-RNICMGRSSA-N |
| XLogP | 0.41 |
| TPSA | 193.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|