C28H47FN5O9P — CID 139331911
hexyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-[(2-hexoxy-2-oxoethyl)amino]phosphoryl]amino]propanoate (PubChem CID 139331911) has the molecular formula C28H47FN5O9P and a molecular weight of 647.68 g/mol. Its IUPAC name is hexyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-[(2-hexoxy-2-oxoethyl)amino]phosphoryl]amino]propanoate.
| Compound Name | hexyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-[(2-hexoxy-2-oxoethyl)amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139331911 |
| Molecular Formula | C28H47FN5O9P |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | hexyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-3-fluoro-4-hydroxyoxolan-2-yl]methoxy-[(2-hexoxy-2-oxoethyl)amino]phosphoryl]amino]propanoate |
| SMILES | C=C[C@]1(COP(=O)(NCC(=O)OCCCCCC)N[C@@H](C)C(=O)OCCCCCC)O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C28H47FN5O9P/c1-5-8-10-12-16-40-22(35)18-31-44(39,33-20(4)26(37)41-17-13-11-9-6-2)42-19-28(7-3)24(29)23(36)25(43-28)34-15-14-21(30)32-27(34)38/h7,14-15,20,23-25,36H,3,5-6,8-13,16-19H2,1-2,4H3,(H2,30,32,38)(H2,31,33,39)/t20-,23+,24-,25+,28+,44?/m0/s1 |
| InChIKey | MBWNEERXJCHJMQ-JUUSDFJSSA-N |
| XLogP | 2.92 |
| TPSA | 193.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|