C15H26N3O8P — CID 100930491
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hexyl hydrogen phosphate (PubChem CID 100930491) has the molecular formula C15H26N3O8P and a molecular weight of 407.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hexyl hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hexyl hydrogen phosphate |
|---|---|
| PubChem CID | 100930491 |
| Molecular Formula | C15H26N3O8P |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hexyl hydrogen phosphate |
| SMILES | CCCCCCOP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26N3O8P/c1-2-3-4-5-8-24-27(22,23)25-9-10-12(19)13(20)14(26-10)18-7-6-11(16)17-15(18)21/h6-7,10,12-14,19-20H,2-5,8-9H2,1H3,(H,22,23)(H2,16,17,21)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | PKNRPLSSULWLAK-FMKGYKFTSA-N |
| XLogP | 0.16 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|