C13H20N3O10P — CID 13255596
4-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxybutanoic acid (PubChem CID 13255596) has the molecular formula C13H20N3O10P and a molecular weight of 409.29 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxybutanoic acid.
| Compound Name | 4-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxybutanoic acid |
|---|---|
| PubChem CID | 13255596 |
| Molecular Formula | C13H20N3O10P |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxybutanoic acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OCCCC(=O)O)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C13H20N3O10P/c14-8-3-4-16(13(21)15-8)12-11(20)10(19)7(26-12)6-25-27(22,23)24-5-1-2-9(17)18/h3-4,7,10-12,19-20H,1-2,5-6H2,(H,17,18)(H,22,23)(H2,14,15,21)/t7-,10-,11+,12-/m1/s1 |
| InChIKey | VDDNHRUWCIDRKL-KPQFEUGASA-N |
| XLogP | -1.56 |
| TPSA | 203.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|