C16H20N3O8P — CID 59007624
[(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzyl hydrogen phosphate (PubChem CID 59007624) has the molecular formula C16H20N3O8P and a molecular weight of 413.32 g/mol. Its IUPAC name is [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzyl hydrogen phosphate.
| Compound Name | [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzyl hydrogen phosphate |
|---|---|
| PubChem CID | 59007624 |
| Molecular Formula | C16H20N3O8P |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(2R,3S,4S)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzyl hydrogen phosphate |
| SMILES | Nc1ccn(C2O[C@H](COP(=O)(O)OCc3ccccc3)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C16H20N3O8P/c17-12-6-7-19(16(22)18-12)15-14(21)13(20)11(27-15)9-26-28(23,24)25-8-10-4-2-1-3-5-10/h1-7,11,13-15,20-21H,8-9H2,(H,23,24)(H2,17,18,22)/t11-,13-,14+,15?/m1/s1 |
| InChIKey | AXVGNDMNHSJEJF-SQPSOYEMSA-N |
| XLogP | -0.22 |
| TPSA | 166.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|