C23H32ClN4O9P — CID 70799147
butyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 70799147) has the molecular formula C23H32ClN4O9P and a molecular weight of 574.96 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70799147 |
| Molecular Formula | C23H32ClN4O9P |
| Molecular Weight | 574.96 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1OC(n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H32ClN4O9P/c1-4-5-12-34-20(30)14(2)27-38(33,37-16-8-6-15(24)7-9-16)35-13-17-19(29)23(3,32)21(36-17)28-11-10-18(25)26-22(28)31/h6-11,14,17,19,21,29,32H,4-5,12-13H2,1-3H3,(H,27,33)(H2,25,26,31)/t14-,17+,19+,21?,23+,38?/m0/s1 |
| InChIKey | RHRWOYUWEVTAKW-WPTNCUQNSA-N |
| XLogP | 2.01 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.96 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|