C28H37N4O9P — CID 71229841
butyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 71229841) has the molecular formula C28H37N4O9P and a molecular weight of 604.60 g/mol. Its IUPAC name is butyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71229841 |
| Molecular Formula | C28H37N4O9P |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | butyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(Oc1cccc2ccccc12)O[C@H](C)[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C28H37N4O9P/c1-5-6-16-38-25(34)17(2)31-42(37,41-21-13-9-11-19-10-7-8-12-20(19)21)40-18(3)23-24(33)28(4,36)26(39-23)32-15-14-22(29)30-27(32)35/h7-15,17-18,23-24,26,33,36H,5-6,16H2,1-4H3,(H,31,37)(H2,29,30,35)/t17-,18+,23+,24+,26+,28+,42?/m0/s1 |
| InChIKey | DXOTYHUGROJLIR-HJKPBIMYSA-N |
| XLogP | 2.90 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|