C24H32N5O8P — CID 90348005
ethyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 90348005) has the molecular formula C24H32N5O8P and a molecular weight of 549.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90348005 |
| Molecular Formula | C24H32N5O8P |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | ethyl (2S)-2-[[[(1R)-1-[(2S,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]ethoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(Oc1ccccc1)O[C@H](C)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C24H32N5O8P/c1-5-34-22(31)14(2)28-38(33,37-16-9-7-6-8-10-16)36-15(3)18-19(30)24(4,32)23(35-18)29-12-11-17-20(25)26-13-27-21(17)29/h6-15,18-19,23,30,32H,5H2,1-4H3,(H,28,33)(H2,25,26,27)/t14-,15+,18+,19+,23+,24+,38?/m0/s1 |
| InChIKey | UZZJDCUAIDLVGE-BPPFVSEXSA-N |
| XLogP | 2.16 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|