C14H20N4O4 — CID 71487534
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-hydroxypropyl)-3-methyloxolane-3,4-diol (PubChem CID 71487534) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-hydroxypropyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-hydroxypropyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 71487534 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-hydroxypropyl)-3-methyloxolane-3,4-diol |
| SMILES | CCC(O)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C14H20N4O4/c1-3-8(19)9-10(20)14(2,21)13(22-9)18-5-4-7-11(15)16-6-17-12(7)18/h4-6,8-10,13,19-21H,3H2,1-2H3,(H2,15,16,17)/t8?,9-,10-,13-,14-/m1/s1 |
| InChIKey | CGMSTHZXBKIXPY-KRHAZILCSA-N |
| XLogP | -0.21 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |