C18H30N4O4Si — CID 59645177
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 59645177) has the molecular formula C18H30N4O4Si and a molecular weight of 394.55 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 59645177 |
| Molecular Formula | C18H30N4O4Si |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C18H30N4O4Si/c1-17(2,3)27(5,6)25-9-12-13(23)18(4,24)16(26-12)22-8-7-11-14(19)20-10-21-15(11)22/h7-8,10,12-13,16,23-24H,9H2,1-6H3,(H2,19,20,21)/t12-,13-,16-,18-/m1/s1 |
| InChIKey | WUQSYGUCSQWPQL-ZHCAMHROSA-N |
| XLogP | 2.04 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|