C24H43FN4O3Si2 — CID 90349714
7-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 90349714) has the molecular formula C24H43FN4O3Si2 and a molecular weight of 510.80 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90349714 |
| Molecular Formula | C24H43FN4O3Si2 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@](C)(F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43FN4O3Si2/c1-22(2,3)33(8,9)30-14-17-18(32-34(10,11)23(4,5)6)24(7,25)21(31-17)29-13-12-16-19(26)27-15-28-20(16)29/h12-13,15,17-18,21H,14H2,1-11H3,(H2,26,27,28)/t17-,18-,21-,24-/m1/s1 |
| InChIKey | NVKAMFWRPWXQHP-ZUXGEGRZSA-N |
| XLogP | 6.05 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|