C36H58N4O7 — CID 87785870
8-[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-3,4-bis(8-oxooctoxy)oxolan-2-yl]methoxy]octanal (PubChem CID 87785870) has the molecular formula C36H58N4O7 and a molecular weight of 658.88 g/mol. Its IUPAC name is 8-[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-3,4-bis(8-oxooctoxy)oxolan-2-yl]methoxy]octanal.
| Compound Name | 8-[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-3,4-bis(8-oxooctoxy)oxolan-2-yl]methoxy]octanal |
|---|---|
| PubChem CID | 87785870 |
| Molecular Formula | C36H58N4O7 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | 8-[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-3,4-bis(8-oxooctoxy)oxolan-2-yl]methoxy]octanal |
| SMILES | C[C@@]1(OCCCCCCCC=O)[C@H](OCCCCCCCC=O)[C@@H](COCCCCCCCC=O)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C36H58N4O7/c1-36(46-27-19-13-7-4-10-16-24-43)32(45-26-18-12-6-3-9-15-23-42)31(28-44-25-17-11-5-2-8-14-22-41)47-35(36)40-21-20-30-33(37)38-29-39-34(30)40/h20-24,29,31-32,35H,2-19,25-28H2,1H3,(H2,37,38,39)/t31-,32-,35-,36-/m1/s1 |
| InChIKey | ASCOYKDSSXVWIV-JPGNECAASA-N |
| XLogP | 6.71 |
| TPSA | 144.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|